C27H19F5O7 — CID 110273993
[(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate (PubChem CID 110273993) has the molecular formula C27H19F5O7 and a molecular weight of 550.43 g/mol. Its IUPAC name is [(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate.
| Compound Name | [(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate |
|---|---|
| PubChem CID | 110273993 |
| Molecular Formula | C27H19F5O7 |
| Molecular Weight | 550.43 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | [(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate |
| SMILES | COc1cccc(/C=C2\Oc3cc(OC(=O)C(C)Oc4c(F)c(F)c(F)c(F)c4F)cc(C)c3C2=O)c1OC |
| InChI | InChI=1S/C27H19F5O7/c1-11-8-14(38-27(34)12(2)37-26-22(31)20(29)19(28)21(30)23(26)32)10-16-18(11)24(33)17(39-16)9-13-6-5-7-15(35-3)25(13)36-4/h5-10,12H,1-4H3/b17-9- |
| InChIKey | QQYFGBCSLMGWSK-MFOYZWKCSA-N |
| XLogP | 5.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|