C29H28O10 — CID 95397774
[(2Z)-4-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3,4,5-trimethoxybenzoate (PubChem CID 95397774) has the molecular formula C29H28O10 and a molecular weight of 536.53 g/mol. Its IUPAC name is [(2Z)-4-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(2Z)-4-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 95397774 |
| Molecular Formula | C29H28O10 |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | [(2Z)-4-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1\Oc2cc(OC(=O)c3cc(OC)c(OC)c(OC)c3)cc(C)c2C1=O |
| InChI | InChI=1S/C29H28O10/c1-15-8-18(38-29(31)17-11-24(35-5)28(37-7)25(12-17)36-6)13-22-26(15)27(30)23(39-22)10-16-9-20(33-3)21(34-4)14-19(16)32-2/h8-14H,1-7H3/b23-10- |
| InChIKey | XVMRLRMAKBJXRO-RMORIDSASA-N |
| XLogP | 4.88 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|