C20H20O7 — CID 15965446
(2Z)-4,6-dimethoxy-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 15965446) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is (2Z)-4,6-dimethoxy-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-4,6-dimethoxy-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 15965446 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (2Z)-4,6-dimethoxy-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1cc(OC)c2c(c1)O/C(=C\c1cc(OC)c(OC)cc1OC)C2=O |
| InChI | InChI=1S/C20H20O7/c1-22-12-8-16(26-5)19-17(9-12)27-18(20(19)21)7-11-6-14(24-3)15(25-4)10-13(11)23-2/h6-10H,1-5H3/b18-7- |
| InChIKey | XYIIDRCLQVNYNO-WSVATBPTSA-N |
| XLogP | 3.35 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|