C21H22O4 — CID 73150985
2-[(4-butylphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3-one (PubChem CID 73150985) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-[(4-butylphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3-one.
| Compound Name | 2-[(4-butylphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 73150985 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[(4-butylphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3-one |
| SMILES | CCCCc1ccc(C=C2Oc3cc(OC)cc(OC)c3C2=O)cc1 |
| InChI | InChI=1S/C21H22O4/c1-4-5-6-14-7-9-15(10-8-14)11-19-21(22)20-17(24-3)12-16(23-2)13-18(20)25-19/h7-13H,4-6H2,1-3H3 |
| InChIKey | KVYRVXOPOWCJFY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|