C19H18O6 — CID 10860799
(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-5,7-dimethoxy-2-benzofuran-1-one (PubChem CID 10860799) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-5,7-dimethoxy-2-benzofuran-1-one.
| Compound Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-5,7-dimethoxy-2-benzofuran-1-one |
|---|---|
| PubChem CID | 10860799 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-5,7-dimethoxy-2-benzofuran-1-one |
| SMILES | COc1cc(OC)c2c(c1)/C(=C/c1ccc(OC)c(OC)c1)OC2=O |
| InChI | InChI=1S/C19H18O6/c1-21-12-9-13-15(25-19(20)18(13)17(10-12)24-4)7-11-5-6-14(22-2)16(8-11)23-3/h5-10H,1-4H3/b15-7- |
| InChIKey | JFHLBESKGOIDIT-CHHVJCJISA-N |
| XLogP | 3.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|