C17H15NO4S — CID 5393187
(1Z)-1-[(2,4-dimethoxyphenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one (PubChem CID 5393187) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is (1Z)-1-[(2,4-dimethoxyphenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one.
| Compound Name | (1Z)-1-[(2,4-dimethoxyphenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 5393187 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (1Z)-1-[(2,4-dimethoxyphenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
| SMILES | COc1ccc(/C=C2\OC(=O)c3c2cc(C)[nH]c3=S)c(OC)c1 |
| InChI | InChI=1S/C17H15NO4S/c1-9-6-12-14(22-17(19)15(12)16(23)18-9)7-10-4-5-11(20-2)8-13(10)21-3/h4-8H,1-3H3,(H,18,23)/b14-7- |
| InChIKey | ZNOVJULRWMXXCE-AUWJEWJLSA-N |
| XLogP | 3.74 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_J(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|