C25H24O5 — CID 11315671
(9E)-9-[(3,4-dimethoxyphenyl)methylidene]-2,3,6-trimethoxyfluorene (PubChem CID 11315671) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is (9E)-9-[(3,4-dimethoxyphenyl)methylidene]-2,3,6-trimethoxyfluorene.
| Compound Name | (9E)-9-[(3,4-dimethoxyphenyl)methylidene]-2,3,6-trimethoxyfluorene |
|---|---|
| PubChem CID | 11315671 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (9E)-9-[(3,4-dimethoxyphenyl)methylidene]-2,3,6-trimethoxyfluorene |
| SMILES | COc1ccc2c(c1)-c1cc(OC)c(OC)cc1/C2=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H24O5/c1-26-16-7-8-17-18(10-15-6-9-22(27-2)23(11-15)28-3)20-13-24(29-4)25(30-5)14-21(20)19(17)12-16/h6-14H,1-5H3/b18-10+ |
| InChIKey | RDMSYPFIIBHGIY-VCHYOVAHSA-N |
| XLogP | 5.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|