C17H15NO4 — CID 67357920
(3Z)-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-6-methoxy-1H-indol-2-one (PubChem CID 67357920) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3Z)-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-6-methoxy-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-6-methoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 67357920 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (3Z)-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-6-methoxy-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)NC(=O)/C2=C\c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C17H15NO4/c1-21-11-4-5-12-13(17(20)18-14(12)9-11)7-10-3-6-16(22-2)15(19)8-10/h3-9,19H,1-2H3,(H,18,20)/b13-7- |
| InChIKey | HWRMDTQMWAGGTH-QPEQYQDCSA-N |
| XLogP | 2.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|