C18H18NO5P — CID 23398029
(3Z)-3-[(4-dimethoxyphosphorylphenyl)methylidene]-6-methoxy-1H-indol-2-one (PubChem CID 23398029) has the molecular formula C18H18NO5P and a molecular weight of 359.32 g/mol. Its IUPAC name is (3Z)-3-[(4-dimethoxyphosphorylphenyl)methylidene]-6-methoxy-1H-indol-2-one.
| Compound Name | (3Z)-3-[(4-dimethoxyphosphorylphenyl)methylidene]-6-methoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 23398029 |
| Molecular Formula | C18H18NO5P |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | (3Z)-3-[(4-dimethoxyphosphorylphenyl)methylidene]-6-methoxy-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)NC(=O)/C2=C\c1ccc(P(=O)(OC)OC)cc1 |
| InChI | InChI=1S/C18H18NO5P/c1-22-13-6-9-15-16(18(20)19-17(15)11-13)10-12-4-7-14(8-5-12)25(21,23-2)24-3/h4-11H,1-3H3,(H,19,20)/b16-10- |
| InChIKey | IKSXOMWDXPVJPU-YBEGLDIGSA-N |
| XLogP | 3.30 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|