C16H17N2O3P — CID 23398037
(3E)-3-[(5-dimethylphosphoryl-1H-pyrrol-2-yl)methylidene]-5-methoxy-1H-indol-2-one (PubChem CID 23398037) has the molecular formula C16H17N2O3P and a molecular weight of 316.30 g/mol. Its IUPAC name is (3E)-3-[(5-dimethylphosphoryl-1H-pyrrol-2-yl)methylidene]-5-methoxy-1H-indol-2-one.
| Compound Name | (3E)-3-[(5-dimethylphosphoryl-1H-pyrrol-2-yl)methylidene]-5-methoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 23398037 |
| Molecular Formula | C16H17N2O3P |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (3E)-3-[(5-dimethylphosphoryl-1H-pyrrol-2-yl)methylidene]-5-methoxy-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)/C(=C\c1ccc(P(C)(C)=O)[nH]1)C(=O)N2 |
| InChI | InChI=1S/C16H17N2O3P/c1-21-11-5-6-14-12(9-11)13(16(19)18-14)8-10-4-7-15(17-10)22(2,3)20/h4-9,17H,1-3H3,(H,18,19)/b13-8+ |
| InChIKey | PAUAKYHYEDCJBN-MDWZMJQESA-N |
| XLogP | 2.76 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|