C23H18N2O5 — CID 69054134
4-benzoyl-5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylic acid (PubChem CID 69054134) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-benzoyl-5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-benzoyl-5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 69054134 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-benzoyl-5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylic acid |
| SMILES | COc1ccc2c(c1)/C(=C/c1[nH]c(C(=O)O)c(C)c1C(=O)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C23H18N2O5/c1-12-19(21(26)13-6-4-3-5-7-13)18(24-20(12)23(28)29)11-16-15-10-14(30-2)8-9-17(15)25-22(16)27/h3-11,24H,1-2H3,(H,25,27)(H,28,29)/b16-11- |
| InChIKey | UYIWFJBUTWLJNW-WJDWOHSUSA-N |
| XLogP | 3.75 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|