C19H17IN2O5 — CID 57073384
2-O-ethyl 4-O-methyl 5-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 57073384) has the molecular formula C19H17IN2O5 and a molecular weight of 480.26 g/mol. Its IUPAC name is 2-O-ethyl 4-O-methyl 5-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-methyl 5-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 57073384 |
| Molecular Formula | C19H17IN2O5 |
| Molecular Weight | 480.26 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 2-O-ethyl 4-O-methyl 5-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(C=C2C(=O)Nc3ccc(I)cc32)c(C(=O)OC)c1C |
| InChI | InChI=1S/C19H17IN2O5/c1-4-27-19(25)16-9(2)15(18(24)26-3)14(21-16)8-12-11-7-10(20)5-6-13(11)22-17(12)23/h5-8,21H,4H2,1-3H3,(H,22,23) |
| InChIKey | WIGXQHHZDVOEGV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|