C18H15IN2O5 — CID 57020118
dimethyl 4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-1H-pyrrole-2,3-dicarboxylate (PubChem CID 57020118) has the molecular formula C18H15IN2O5 and a molecular weight of 466.23 g/mol. Its IUPAC name is dimethyl 4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-1H-pyrrole-2,3-dicarboxylate.
| Compound Name | dimethyl 4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-1H-pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 57020118 |
| Molecular Formula | C18H15IN2O5 |
| Molecular Weight | 466.23 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | dimethyl 4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-1H-pyrrole-2,3-dicarboxylate |
| SMILES | COC(=O)c1[nH]c(C)c(C=C2C(=O)Nc3ccc(I)cc32)c1C(=O)OC |
| InChI | InChI=1S/C18H15IN2O5/c1-8-10(14(17(23)25-2)15(20-8)18(24)26-3)7-12-11-6-9(19)4-5-13(11)21-16(12)22/h4-7,20H,1-3H3,(H,21,22) |
| InChIKey | AOENHWYWBGXWHM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|