C15H10INO3Se — CID 74943700
5-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-2-methylselenophene-3-carboxylic acid (PubChem CID 74943700) has the molecular formula C15H10INO3Se and a molecular weight of 458.11 g/mol. Its IUPAC name is 5-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-2-methylselenophene-3-carboxylic acid.
| Compound Name | 5-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-2-methylselenophene-3-carboxylic acid |
|---|---|
| PubChem CID | 74943700 |
| Molecular Formula | C15H10INO3Se |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 458.89 |
| IUPAC Name | 5-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]-2-methylselenophene-3-carboxylic acid |
| SMILES | Cc1[se]c(C=C2C(=O)Nc3ccc(I)cc32)cc1C(=O)O |
| InChI | InChI=1S/C15H10INO3Se/c1-7-10(15(19)20)5-9(21-7)6-12-11-4-8(16)2-3-13(11)17-14(12)18/h2-6H,1H3,(H,17,18)(H,19,20) |
| InChIKey | WSECILKQQYPMDQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|