C22H17NO5Se — CID 74943767
5-[[6-(4-hydroxy-2-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-2-methylselenophene-3-carboxylic acid (PubChem CID 74943767) has the molecular formula C22H17NO5Se and a molecular weight of 454.34 g/mol. Its IUPAC name is 5-[[6-(4-hydroxy-2-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-2-methylselenophene-3-carboxylic acid.
| Compound Name | 5-[[6-(4-hydroxy-2-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-2-methylselenophene-3-carboxylic acid |
|---|---|
| PubChem CID | 74943767 |
| Molecular Formula | C22H17NO5Se |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 5-[[6-(4-hydroxy-2-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-2-methylselenophene-3-carboxylic acid |
| SMILES | COc1cc(O)ccc1-c1ccc2c(c1)NC(=O)C2=Cc1cc(C(=O)O)c(C)[se]1 |
| InChI | InChI=1S/C22H17NO5Se/c1-11-17(22(26)27)9-14(29-11)10-18-16-5-3-12(7-19(16)23-21(18)25)15-6-4-13(24)8-20(15)28-2/h3-10,24H,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | SVFFLLKGXSZFBY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|