C25H22N2O6 — CID 22500250
4-(2-carboxyethyl)-5-[(2Z)-2-[6-(2-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]ethyl]-1H-pyrrole-3-carboxylic acid (PubChem CID 22500250) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is 4-(2-carboxyethyl)-5-[(2Z)-2-[6-(2-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]ethyl]-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-(2-carboxyethyl)-5-[(2Z)-2-[6-(2-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]ethyl]-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 22500250 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 4-(2-carboxyethyl)-5-[(2Z)-2-[6-(2-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]ethyl]-1H-pyrrole-3-carboxylic acid |
| SMILES | COc1ccccc1-c1ccc2c(c1)NC(=O)/C2=C\Cc1[nH]cc(C(=O)O)c1CCC(=O)O |
| InChI | InChI=1S/C25H22N2O6/c1-33-22-5-3-2-4-15(22)14-6-7-16-18(24(30)27-21(16)12-14)8-10-20-17(9-11-23(28)29)19(13-26-20)25(31)32/h2-8,12-13,26H,9-11H2,1H3,(H,27,30)(H,28,29)(H,31,32)/b18-8- |
| InChIKey | DTZHENKXDIYVGR-LSCVHKIXSA-N |
| XLogP | 3.98 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|