C32H26ClNO4S — CID 144760612
2-[5-[(2Z)-2-[6-chloro-5-[4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1H-indol-3-ylidene]ethyl]-2-methoxyphenyl]acetic acid (PubChem CID 144760612) has the molecular formula C32H26ClNO4S and a molecular weight of 556.08 g/mol. Its IUPAC name is 2-[5-[(2Z)-2-[6-chloro-5-[4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1H-indol-3-ylidene]ethyl]-2-methoxyphenyl]acetic acid.
| Compound Name | 2-[5-[(2Z)-2-[6-chloro-5-[4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1H-indol-3-ylidene]ethyl]-2-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 144760612 |
| Molecular Formula | C32H26ClNO4S |
| Molecular Weight | 556.08 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 2-[5-[(2Z)-2-[6-chloro-5-[4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1H-indol-3-ylidene]ethyl]-2-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(C/C=C2\C(=O)Nc3cc(Cl)c(-c4ccc(-c5ccc(SC)cc5)cc4)cc32)cc1CC(=O)O |
| InChI | InChI=1S/C32H26ClNO4S/c1-38-30-14-4-19(15-23(30)16-31(35)36)3-13-25-27-17-26(28(33)18-29(27)34-32(25)37)22-7-5-20(6-8-22)21-9-11-24(39-2)12-10-21/h4-15,17-18H,3,16H2,1-2H3,(H,34,37)(H,35,36)/b25-13- |
| InChIKey | PCZLKNONTYXUSQ-MXAYSNPKSA-N |
| XLogP | 7.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.08 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|