C27H19ClN2O4 — CID 140758386
4-[(Z)-[6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-indol-3-ylidene]methyl]-1-methylpyrrole-2-carboxylic acid (PubChem CID 140758386) has the molecular formula C27H19ClN2O4 and a molecular weight of 470.91 g/mol. Its IUPAC name is 4-[(Z)-[6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-indol-3-ylidene]methyl]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[(Z)-[6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-indol-3-ylidene]methyl]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 140758386 |
| Molecular Formula | C27H19ClN2O4 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 4-[(Z)-[6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-indol-3-ylidene]methyl]-1-methylpyrrole-2-carboxylic acid |
| SMILES | Cn1cc(/C=C2\C(=O)Nc3cc(Cl)c(-c4ccc(-c5ccccc5O)cc4)cc32)cc1C(=O)O |
| InChI | InChI=1S/C27H19ClN2O4/c1-30-14-15(11-24(30)27(33)34)10-21-20-12-19(22(28)13-23(20)29-26(21)32)17-8-6-16(7-9-17)18-4-2-3-5-25(18)31/h2-14,31H,1H3,(H,29,32)(H,33,34)/b21-10- |
| InChIKey | XEIQGOSWTSNIIR-FBHDLOMBSA-N |
| XLogP | 5.91 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|