C15H9I2NO2 — CID 69304942
(3Z)-3-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1H-indol-2-one (PubChem CID 69304942) has the molecular formula C15H9I2NO2 and a molecular weight of 489.05 g/mol. Its IUPAC name is (3Z)-3-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 69304942 |
| Molecular Formula | C15H9I2NO2 |
| Molecular Weight | 489.05 g/mol |
| Exact Mass | 488.87 |
| IUPAC Name | (3Z)-3-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C/c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C15H9I2NO2/c16-11-6-8(7-12(17)14(11)19)5-10-9-3-1-2-4-13(9)18-15(10)20/h1-7,19H,(H,18,20)/b10-5- |
| InChIKey | QQAINFWEWIDOBF-YHYXMXQVSA-N |
| XLogP | 4.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.05 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|