C15H10INO3 — CID 57236339
3-[(3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one (PubChem CID 57236339) has the molecular formula C15H10INO3 and a molecular weight of 379.15 g/mol. Its IUPAC name is 3-[(3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one.
| Compound Name | 3-[(3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one |
|---|---|
| PubChem CID | 57236339 |
| Molecular Formula | C15H10INO3 |
| Molecular Weight | 379.15 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 3-[(3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(I)cc2C1=Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H10INO3/c16-9-1-2-14-12(6-9)13(15(20)17-14)5-8-3-10(18)7-11(19)4-8/h1-7,18-19H,(H,17,20) |
| InChIKey | VKBULAWIUZHLIW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.15 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|