About 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one
3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one (PubChem CID 4115418) has the molecular formula C15H9BrINO3
and a molecular weight of 458.05 g/mol. Its IUPAC name is 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one.
Molecular Properties
| Compound Name | 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one |
| PubChem CID | 4115418 |
| Molecular Formula | C15H9BrINO3 |
| Molecular Weight | 458.05 g/mol |
| Exact Mass | 456.88 |
| IUPAC Name | 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(I)cc2C1=Cc1cc(O)c(Br)c(O)c1 |
| InChI | InChI=1S/C15H9BrINO3/c16-14-12(19)4-7(5-13(14)20)3-10-9-6-8(17)1-2-11(9)18-15(10)21/h1-6,19-20H,(H,18,21) |
| InChIKey | GVHSQCLAZLNKOB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.05 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one?
The IUPAC name of 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one (CID 4115418) is 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one.
What is the SMILES notation for 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one?
The canonical SMILES for 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one is O=C1Nc2ccc(I)cc2C1=Cc1cc(O)c(Br)c(O)c1.
What is the InChIKey of 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one?
The InChIKey is GVHSQCLAZLNKOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrINO3/c16-14-12(19)4-7(5-13(14)20)3-10-9-6-8(17)1-2-11(9)18-15(10)21/h1-6,19-20H,(H,18,21).
What are the key properties of 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one?
3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one has a molecular weight of 458.05 g/mol, XLogP of 3.96, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one is sourced from PubChem (CID 4115418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).