C15H9BrINO3 — CID 4115418
3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one (PubChem CID 4115418) has the molecular formula C15H9BrINO3 and a molecular weight of 458.05 g/mol. Its IUPAC name is 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one.
| Compound Name | 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one |
|---|---|
| PubChem CID | 4115418 |
| Molecular Formula | C15H9BrINO3 |
| Molecular Weight | 458.05 g/mol |
| Exact Mass | 456.88 |
| IUPAC Name | 3-[(4-bromo-3,5-dihydroxyphenyl)methylidene]-5-iodo-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(I)cc2C1=Cc1cc(O)c(Br)c(O)c1 |
| InChI | InChI=1S/C15H9BrINO3/c16-14-12(19)4-7(5-13(14)20)3-10-9-6-8(17)1-2-11(9)18-15(10)21/h1-6,19-20H,(H,18,21) |
| InChIKey | GVHSQCLAZLNKOB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.05 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|