C21H18Br2INO4 — CID 70242307
4-[2,6-dibromo-4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-2,2-dimethylbutanoic acid (PubChem CID 70242307) has the molecular formula C21H18Br2INO4 and a molecular weight of 635.09 g/mol. Its IUPAC name is 4-[2,6-dibromo-4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[2,6-dibromo-4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 70242307 |
| Molecular Formula | C21H18Br2INO4 |
| Molecular Weight | 635.09 g/mol |
| Exact Mass | 632.86 |
| IUPAC Name | 4-[2,6-dibromo-4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCOc1c(Br)cc(C=C2C(=O)Nc3ccc(I)cc32)cc1Br)C(=O)O |
| InChI | InChI=1S/C21H18Br2INO4/c1-21(2,20(27)28)5-6-29-18-15(22)8-11(9-16(18)23)7-14-13-10-12(24)3-4-17(13)25-19(14)26/h3-4,7-10H,5-6H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | CSUQCMHQCCWXON-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.09 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|