C23H17Br2NO2 — CID 126126515
(3Z)-3-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1H-indol-2-one (PubChem CID 126126515) has the molecular formula C23H17Br2NO2 and a molecular weight of 499.20 g/mol. Its IUPAC name is (3Z)-3-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 126126515 |
| Molecular Formula | C23H17Br2NO2 |
| Molecular Weight | 499.20 g/mol |
| Exact Mass | 496.96 |
| IUPAC Name | (3Z)-3-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
| SMILES | Cc1ccc(COc2c(Br)cc(/C=C3\C(=O)Nc4ccccc43)cc2Br)cc1 |
| InChI | InChI=1S/C23H17Br2NO2/c1-14-6-8-15(9-7-14)13-28-22-19(24)11-16(12-20(22)25)10-18-17-4-2-3-5-21(17)26-23(18)27/h2-12H,13H2,1H3,(H,26,27)/b18-10- |
| InChIKey | VUZZUDRFOKLHBN-ZDLGFXPLSA-N |
| XLogP | 6.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.20 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|