C17H13BBrNO2 — CID 177342268
CID 177342268 (PubChem CID 177342268) has the molecular formula C17H13BBrNO2 and a molecular weight of 354.01 g/mol.
| Compound Name | CID 177342268 |
|---|---|
| PubChem CID | 177342268 |
| Molecular Formula | C17H13BBrNO2 |
| Molecular Weight | 354.01 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | — |
| SMILES | [B]c1cc(/C=C2\C(=O)Nc3ccc(C)cc32)cc(Br)c1OC |
| InChI | InChI=1S/C17H13BBrNO2/c1-9-3-4-15-11(5-9)12(17(21)20-15)6-10-7-13(18)16(22-2)14(19)8-10/h3-8H,1-2H3,(H,20,21)/b12-6- |
| InChIKey | HPSVOWQCJQIYBP-SDQBBNPISA-N |
| XLogP | 3.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.01 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|