C16H11BrClNO3 — CID 6091635
(3E)-3-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-5-chloro-1H-indol-2-one (PubChem CID 6091635) has the molecular formula C16H11BrClNO3 and a molecular weight of 380.63 g/mol. Its IUPAC name is (3E)-3-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-5-chloro-1H-indol-2-one.
| Compound Name | (3E)-3-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-5-chloro-1H-indol-2-one |
|---|---|
| PubChem CID | 6091635 |
| Molecular Formula | C16H11BrClNO3 |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | (3E)-3-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-5-chloro-1H-indol-2-one |
| SMILES | COc1cc(/C=C2/C(=O)Nc3ccc(Cl)cc32)cc(Br)c1O |
| InChI | InChI=1S/C16H11BrClNO3/c1-22-14-6-8(5-12(17)15(14)20)4-11-10-7-9(18)2-3-13(10)19-16(11)21/h2-7,20H,1H3,(H,19,21)/b11-4+ |
| InChIKey | CHLACSNNPFOGIL-NYYWCZLTSA-N |
| XLogP | 4.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|