C16H11Br2NO3 — CID 118714393
(3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-methoxy-1H-indol-2-one (PubChem CID 118714393) has the molecular formula C16H11Br2NO3 and a molecular weight of 425.08 g/mol. Its IUPAC name is (3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-methoxy-1H-indol-2-one.
| Compound Name | (3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-methoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 118714393 |
| Molecular Formula | C16H11Br2NO3 |
| Molecular Weight | 425.08 g/mol |
| Exact Mass | 422.91 |
| IUPAC Name | (3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-methoxy-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)/C(=C\c1cc(Br)c(O)c(Br)c1)C(=O)N2 |
| InChI | InChI=1S/C16H11Br2NO3/c1-22-9-2-3-14-10(7-9)11(16(21)19-14)4-8-5-12(17)15(20)13(18)6-8/h2-7,20H,1H3,(H,19,21)/b11-4+ |
| InChIKey | OPXMZBNECOFPFD-NYYWCZLTSA-N |
| XLogP | 4.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.08 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|