C17H8Br2F3NO3 — CID 72608342
3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-(2,2,2-trifluoroacetyl)-1H-indol-2-one (PubChem CID 72608342) has the molecular formula C17H8Br2F3NO3 and a molecular weight of 491.06 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-(2,2,2-trifluoroacetyl)-1H-indol-2-one.
| Compound Name | 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-(2,2,2-trifluoroacetyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 72608342 |
| Molecular Formula | C17H8Br2F3NO3 |
| Molecular Weight | 491.06 g/mol |
| Exact Mass | 488.88 |
| IUPAC Name | 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-(2,2,2-trifluoroacetyl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(C(=O)C(F)(F)F)cc2C1=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C17H8Br2F3NO3/c18-11-4-7(5-12(19)14(11)24)3-10-9-6-8(15(25)17(20,21)22)1-2-13(9)23-16(10)26/h1-6,24H,(H,23,26) |
| InChIKey | AQVLOWBZSMUTAH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.06 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|