C16H8F3I2NO3 — CID 69305785
(3Z)-3-[(4-hydroxy-3,5-diiodophenyl)methylidene]-5-(trifluoromethoxy)-1H-indol-2-one (PubChem CID 69305785) has the molecular formula C16H8F3I2NO3 and a molecular weight of 573.05 g/mol. Its IUPAC name is (3Z)-3-[(4-hydroxy-3,5-diiodophenyl)methylidene]-5-(trifluoromethoxy)-1H-indol-2-one.
| Compound Name | (3Z)-3-[(4-hydroxy-3,5-diiodophenyl)methylidene]-5-(trifluoromethoxy)-1H-indol-2-one |
|---|---|
| PubChem CID | 69305785 |
| Molecular Formula | C16H8F3I2NO3 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.85 |
| IUPAC Name | (3Z)-3-[(4-hydroxy-3,5-diiodophenyl)methylidene]-5-(trifluoromethoxy)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(OC(F)(F)F)cc2/C1=C/c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C16H8F3I2NO3/c17-16(18,19)25-8-1-2-13-9(6-8)10(15(24)22-13)3-7-4-11(20)14(23)12(21)5-7/h1-6,23H,(H,22,24)/b10-3- |
| InChIKey | CZBGJXXRMDSGKY-KMKOMSMNSA-N |
| XLogP | 4.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|