C16H13F3N2O2 — CID 46233648
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(trifluoromethoxy)-1H-indol-2-one (PubChem CID 46233648) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(trifluoromethoxy)-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(trifluoromethoxy)-1H-indol-2-one |
|---|---|
| PubChem CID | 46233648 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(trifluoromethoxy)-1H-indol-2-one |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)Nc3ccc(OC(F)(F)F)cc32)[nH]1 |
| InChI | InChI=1S/C16H13F3N2O2/c1-8-5-9(2)20-14(8)7-12-11-6-10(23-16(17,18)19)3-4-13(11)21-15(12)22/h3-7,20H,1-2H3,(H,21,22)/b12-7- |
| InChIKey | LNBSZRVNUUFWGW-GHXNOFRVSA-N |
| XLogP | 4.02 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|