C25H25N3O3 — CID 123922111
3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-N-[1-(4-methoxyphenyl)ethyl]-2-oxo-1H-indole-5-carboxamide (PubChem CID 123922111) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-N-[1-(4-methoxyphenyl)ethyl]-2-oxo-1H-indole-5-carboxamide.
| Compound Name | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-N-[1-(4-methoxyphenyl)ethyl]-2-oxo-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 123922111 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-N-[1-(4-methoxyphenyl)ethyl]-2-oxo-1H-indole-5-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)c2ccc3c(c2)C(=Cc2[nH]c(C)cc2C)C(=O)N3)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-14-11-15(2)26-23(14)13-21-20-12-18(7-10-22(20)28-25(21)30)24(29)27-16(3)17-5-8-19(31-4)9-6-17/h5-13,16,26H,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | SGJRETBOPBDFKC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|