C16H16N4O — CID 57273130
3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indole-5-carboximidamide (PubChem CID 57273130) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indole-5-carboximidamide.
| Compound Name | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indole-5-carboximidamide |
|---|---|
| PubChem CID | 57273130 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C(=Cc1[nH]c(C)cc1C)C(=O)N2 |
| InChI | InChI=1S/C16H16N4O/c1-8-5-9(2)19-14(8)7-12-11-6-10(15(17)18)3-4-13(11)20-16(12)21/h3-7,19H,1-2H3,(H3,17,18)(H,20,21) |
| InChIKey | QDSTXZUNXYOABH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|