C23H19N3O — CID 140699759
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-6-(3-isocyano-2-methylphenyl)-1H-indol-2-one (PubChem CID 140699759) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-6-(3-isocyano-2-methylphenyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-6-(3-isocyano-2-methylphenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 140699759 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-6-(3-isocyano-2-methylphenyl)-1H-indol-2-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)NC(=O)/C3=C\c2[nH]c(C)cc2C)c1C |
| InChI | InChI=1S/C23H19N3O/c1-13-10-14(2)25-21(13)12-19-18-9-8-16(11-22(18)26-23(19)27)17-6-5-7-20(24-4)15(17)3/h5-12,25H,1-3H3,(H,26,27)/b19-12- |
| InChIKey | DZGOIBRAWDNNFW-UNOMPAQXSA-N |
| XLogP | 5.65 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|