C20H18N4O2 — CID 118696399
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-(2-methoxypyrimidin-5-yl)-1H-indol-2-one (PubChem CID 118696399) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-(2-methoxypyrimidin-5-yl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-(2-methoxypyrimidin-5-yl)-1H-indol-2-one |
|---|---|
| PubChem CID | 118696399 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-(2-methoxypyrimidin-5-yl)-1H-indol-2-one |
| SMILES | COc1ncc(-c2cccc3c2NC(=O)/C3=C\c2[nH]c(C)cc2C)cn1 |
| InChI | InChI=1S/C20H18N4O2/c1-11-7-12(2)23-17(11)8-16-15-6-4-5-14(18(15)24-19(16)25)13-9-21-20(26-3)22-10-13/h4-10,23H,1-3H3,(H,24,25)/b16-8- |
| InChIKey | WMIPPPPARYWRSU-PXNMLYILSA-N |
| XLogP | 3.59 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|