C24H19N3O — CID 118696406
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-isoquinolin-4-yl-1H-indol-2-one (PubChem CID 118696406) has the molecular formula C24H19N3O and a molecular weight of 365.44 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-isoquinolin-4-yl-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-isoquinolin-4-yl-1H-indol-2-one |
|---|---|
| PubChem CID | 118696406 |
| Molecular Formula | C24H19N3O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-isoquinolin-4-yl-1H-indol-2-one |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)Nc3c2cccc3-c2cncc3ccccc23)[nH]1 |
| InChI | InChI=1S/C24H19N3O/c1-14-10-15(2)26-22(14)11-20-18-8-5-9-19(23(18)27-24(20)28)21-13-25-12-16-6-3-4-7-17(16)21/h3-13,26H,1-2H3,(H,27,28)/b20-11- |
| InChIKey | WXLKKRABYICDIH-JAIQZWGSSA-N |
| XLogP | 5.34 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|