C15H13ClN2O — CID 11482682
(3Z)-4-chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one (PubChem CID 11482682) has the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. Its IUPAC name is (3Z)-4-chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-4-chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 11482682 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (3Z)-4-chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)Nc3cccc(Cl)c32)[nH]1 |
| InChI | InChI=1S/C15H13ClN2O/c1-8-6-9(2)17-13(8)7-10-14-11(16)4-3-5-12(14)18-15(10)19/h3-7,17H,1-2H3,(H,18,19)/b10-7- |
| InChIKey | DISKJMRROFWGRK-YFHOEESVSA-N |
| XLogP | 3.78 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|