C11H11NO — CID 58635316
(3Z)-3-ethylidene-4-methyl-1H-indol-2-one (PubChem CID 58635316) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is (3Z)-3-ethylidene-4-methyl-1H-indol-2-one.
| Compound Name | (3Z)-3-ethylidene-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 58635316 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | (3Z)-3-ethylidene-4-methyl-1H-indol-2-one |
| SMILES | C/C=C1\C(=O)Nc2cccc(C)c21 |
| InChI | InChI=1S/C11H11NO/c1-3-8-10-7(2)5-4-6-9(10)12-11(8)13/h3-6H,1-2H3,(H,12,13)/b8-3- |
| InChIKey | RKQQPHKBKPPYCI-BAQGIRSFSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|