C16H14N2O2 — CID 170859544
1,7-dimethyl-5,11-dihydrobenzo[c][1,5]benzodiazocine-6,12-dione (PubChem CID 170859544) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1,7-dimethyl-5,11-dihydrobenzo[c][1,5]benzodiazocine-6,12-dione.
| Compound Name | 1,7-dimethyl-5,11-dihydrobenzo[c][1,5]benzodiazocine-6,12-dione |
|---|---|
| PubChem CID | 170859544 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1,7-dimethyl-5,11-dihydrobenzo[c][1,5]benzodiazocine-6,12-dione |
| SMILES | Cc1cccc2c1C(=O)Nc1cccc(C)c1C(=O)N2 |
| InChI | InChI=1S/C16H14N2O2/c1-9-5-3-7-11-13(9)15(19)18-12-8-4-6-10(2)14(12)16(20)17-11/h3-8H,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | UQQYIMQLXSEAEA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |