C13H10N2O — CID 142017800
(1Z)-1-ethylidene-3H-pyrrolo[3,2-f]quinolin-2-one (PubChem CID 142017800) has the molecular formula C13H10N2O and a molecular weight of 210.24 g/mol. Its IUPAC name is (1Z)-1-ethylidene-3H-pyrrolo[3,2-f]quinolin-2-one.
| Compound Name | (1Z)-1-ethylidene-3H-pyrrolo[3,2-f]quinolin-2-one |
|---|---|
| PubChem CID | 142017800 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (1Z)-1-ethylidene-3H-pyrrolo[3,2-f]quinolin-2-one |
| SMILES | C/C=C1\C(=O)Nc2ccc3ncccc3c21 |
| InChI | InChI=1S/C13H10N2O/c1-2-8-12-9-4-3-7-14-10(9)5-6-11(12)15-13(8)16/h2-7H,1H3,(H,15,16)/b8-2- |
| InChIKey | FYZOFZSLHCYDDC-WAPJZHGLSA-N |
| XLogP | 2.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|