C17H22N2O — CID 142017819
(1Z)-1-butylidene-3H-pyrrolo[3,2-f]quinolin-2-one;ethane;molecular hydrogen (PubChem CID 142017819) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (1Z)-1-butylidene-3H-pyrrolo[3,2-f]quinolin-2-one;ethane;molecular hydrogen.
| Compound Name | (1Z)-1-butylidene-3H-pyrrolo[3,2-f]quinolin-2-one;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 142017819 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (1Z)-1-butylidene-3H-pyrrolo[3,2-f]quinolin-2-one;ethane;molecular hydrogen |
| SMILES | CC.CCC/C=C1\C(=O)Nc2ccc3ncccc3c21.[H][H] |
| InChI | InChI=1S/C15H14N2O.C2H6.H2/c1-2-3-5-11-14-10-6-4-9-16-12(10)7-8-13(14)17-15(11)18;1-2;/h4-9H,2-3H2,1H3,(H,17,18);1-2H3;1H/b11-5-;; |
| InChIKey | LCRONQIWLKIJEZ-PHTSJKJYSA-N |
| XLogP | 4.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|