About ethane;5-ethylquinoline
ethane;5-ethylquinoline (PubChem CID 143401043) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is ethane;5-ethylquinoline.
Molecular Properties
| Compound Name | ethane;5-ethylquinoline |
| PubChem CID | 143401043 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | ethane;5-ethylquinoline |
| SMILES | CC.CCc1cccc2ncccc12 |
| InChI | InChI=1S/C11H11N.C2H6/c1-2-9-5-3-7-11-10(9)6-4-8-12-11;1-2/h3-8H,2H2,1H3;1-2H3 |
| InChIKey | GAFNZFIXGTWSAV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-ethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethylquinoline?
The IUPAC name of ethane;5-ethylquinoline (CID 143401043) is ethane;5-ethylquinoline.
What is the SMILES notation for ethane;5-ethylquinoline?
The canonical SMILES for ethane;5-ethylquinoline is CC.CCc1cccc2ncccc12.
What is the InChIKey of ethane;5-ethylquinoline?
The InChIKey is GAFNZFIXGTWSAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N.C2H6/c1-2-9-5-3-7-11-10(9)6-4-8-12-11;1-2/h3-8H,2H2,1H3;1-2H3.
What are the key properties of ethane;5-ethylquinoline?
ethane;5-ethylquinoline has a molecular weight of 187.29 g/mol, XLogP of 3.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethylquinoline is sourced from PubChem (CID 143401043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).