About 3-quinolin-5-ylpropanoic acid
3-quinolin-5-ylpropanoic acid (PubChem CID 81224223) has the molecular formula C12H11NO2
and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-quinolin-5-ylpropanoic acid.
Molecular Properties
| Compound Name | 3-quinolin-5-ylpropanoic acid |
| PubChem CID | 81224223 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-quinolin-5-ylpropanoic acid |
| SMILES | O=C(O)CCc1cccc2ncccc12 |
| InChI | InChI=1S/C12H11NO2/c14-12(15)7-6-9-3-1-5-11-10(9)4-2-8-13-11/h1-5,8H,6-7H2,(H,14,15) |
| InChIKey | ZYPNJYVATBRGFQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-quinolin-5-ylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-quinolin-5-ylpropanoic acid?
The IUPAC name of 3-quinolin-5-ylpropanoic acid (CID 81224223) is 3-quinolin-5-ylpropanoic acid.
What is the SMILES notation for 3-quinolin-5-ylpropanoic acid?
The canonical SMILES for 3-quinolin-5-ylpropanoic acid is O=C(O)CCc1cccc2ncccc12.
What is the InChIKey of 3-quinolin-5-ylpropanoic acid?
The InChIKey is ZYPNJYVATBRGFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c14-12(15)7-6-9-3-1-5-11-10(9)4-2-8-13-11/h1-5,8H,6-7H2,(H,14,15).
What are the key properties of 3-quinolin-5-ylpropanoic acid?
3-quinolin-5-ylpropanoic acid has a molecular weight of 201.23 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-quinolin-5-ylpropanoic acid is sourced from PubChem (CID 81224223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).