About 5-bromoquinoline;ethane
5-bromoquinoline;ethane (PubChem CID 142484600) has the molecular formula C11H12BrN
and a molecular weight of 238.13 g/mol. Its IUPAC name is 5-bromoquinoline;ethane.
Molecular Properties
| Compound Name | 5-bromoquinoline;ethane |
| PubChem CID | 142484600 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 5-bromoquinoline;ethane |
| SMILES | Brc1cccc2ncccc12.CC |
| InChI | InChI=1S/C9H6BrN.C2H6/c10-8-4-1-5-9-7(8)3-2-6-11-9;1-2/h1-6H;1-2H3 |
| InChIKey | YTVZYGMTTAMOKG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromoquinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromoquinoline;ethane?
The IUPAC name of 5-bromoquinoline;ethane (CID 142484600) is 5-bromoquinoline;ethane.
What is the SMILES notation for 5-bromoquinoline;ethane?
The canonical SMILES for 5-bromoquinoline;ethane is Brc1cccc2ncccc12.CC.
What is the InChIKey of 5-bromoquinoline;ethane?
The InChIKey is YTVZYGMTTAMOKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrN.C2H6/c10-8-4-1-5-9-7(8)3-2-6-11-9;1-2/h1-6H;1-2H3.
What are the key properties of 5-bromoquinoline;ethane?
5-bromoquinoline;ethane has a molecular weight of 238.13 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromoquinoline;ethane is sourced from PubChem (CID 142484600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).