C31H34BrN3O2P2 — CID 157268291
5-bromoquinoline;5-dimethylphosphorylquinoline;5-dimethylphosphoryl-1,2,3,4-tetrahydroquinoline (PubChem CID 157268291) has the molecular formula C31H34BrN3O2P2 and a molecular weight of 622.48 g/mol. Its IUPAC name is 5-bromoquinoline;5-dimethylphosphorylquinoline;5-dimethylphosphoryl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-bromoquinoline;5-dimethylphosphorylquinoline;5-dimethylphosphoryl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 157268291 |
| Molecular Formula | C31H34BrN3O2P2 |
| Molecular Weight | 622.48 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | 5-bromoquinoline;5-dimethylphosphorylquinoline;5-dimethylphosphoryl-1,2,3,4-tetrahydroquinoline |
| SMILES | Brc1cccc2ncccc12.CP(C)(=O)c1cccc2c1CCCN2.CP(C)(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C11H16NOP.C11H12NOP.C9H6BrN/c2*1-14(2,13)11-7-3-6-10-9(11)5-4-8-12-10;10-8-4-1-5-9-7(8)3-2-6-11-9/h3,6-7,12H,4-5,8H2,1-2H3;3-8H,1-2H3;1-6H |
| InChIKey | AYGAHKQUQPQZLH-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.48 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|