C10H15Cl2NO — CID 133058760
5-methoxy-1,2,3,4-tetrahydroquinoline;dihydrochloride (PubChem CID 133058760) has the molecular formula C10H15Cl2NO and a molecular weight of 236.14 g/mol. Its IUPAC name is 5-methoxy-1,2,3,4-tetrahydroquinoline;dihydrochloride.
| Compound Name | 5-methoxy-1,2,3,4-tetrahydroquinoline;dihydrochloride |
|---|---|
| PubChem CID | 133058760 |
| Molecular Formula | C10H15Cl2NO |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 5-methoxy-1,2,3,4-tetrahydroquinoline;dihydrochloride |
| SMILES | COc1cccc2c1CCCN2.Cl.Cl |
| InChI | InChI=1S/C10H13NO.2ClH/c1-12-10-6-2-5-9-8(10)4-3-7-11-9;;/h2,5-6,11H,3-4,7H2,1H3;2*1H |
| InChIKey | OBAQTOSAAGCVRR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |