C11H15BrClNO — CID 67827017
6-bromo-7-methoxy-2,3,4,5-tetrahydro-1H-1-benzazepine;hydrochloride (PubChem CID 67827017) has the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. Its IUPAC name is 6-bromo-7-methoxy-2,3,4,5-tetrahydro-1H-1-benzazepine;hydrochloride.
| Compound Name | 6-bromo-7-methoxy-2,3,4,5-tetrahydro-1H-1-benzazepine;hydrochloride |
|---|---|
| PubChem CID | 67827017 |
| Molecular Formula | C11H15BrClNO |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 6-bromo-7-methoxy-2,3,4,5-tetrahydro-1H-1-benzazepine;hydrochloride |
| SMILES | COc1ccc2c(c1Br)CCCCN2.Cl |
| InChI | InChI=1S/C11H14BrNO.ClH/c1-14-10-6-5-9-8(11(10)12)4-2-3-7-13-9;/h5-6,13H,2-4,7H2,1H3;1H |
| InChIKey | XXJBFTZRNFDGDV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|