C9H9BrO2 — CID 83918290
4-bromo-5-methoxy-2,3-dihydro-1-benzofuran (PubChem CID 83918290) has the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. Its IUPAC name is 4-bromo-5-methoxy-2,3-dihydro-1-benzofuran.
| Compound Name | 4-bromo-5-methoxy-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 83918290 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 4-bromo-5-methoxy-2,3-dihydro-1-benzofuran |
| SMILES | COc1ccc2c(c1Br)CCO2 |
| InChI | InChI=1S/C9H9BrO2/c1-11-8-3-2-7-6(9(8)10)4-5-12-7/h2-3H,4-5H2,1H3 |
| InChIKey | PMDHFFJBVWKUQN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |