C9H11NO2 — CID 82373059
4-methoxy-2,3-dihydro-1-benzofuran-7-amine (PubChem CID 82373059) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 4-methoxy-2,3-dihydro-1-benzofuran-7-amine.
| Compound Name | 4-methoxy-2,3-dihydro-1-benzofuran-7-amine |
|---|---|
| PubChem CID | 82373059 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4-methoxy-2,3-dihydro-1-benzofuran-7-amine |
| SMILES | COc1ccc(N)c2c1CCO2 |
| InChI | InChI=1S/C9H11NO2/c1-11-8-3-2-7(10)9-6(8)4-5-12-9/h2-3H,4-5,10H2,1H3 |
| InChIKey | PMKNQUSGJAGDFE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|