C11H16N2O — CID 84664219
5-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-amine (PubChem CID 84664219) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-amine.
| Compound Name | 5-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 84664219 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 5-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-amine |
| SMILES | COc1ccc(N)c2c1CCNC2C |
| InChI | InChI=1S/C11H16N2O/c1-7-11-8(5-6-13-7)10(14-2)4-3-9(11)12/h3-4,7,13H,5-6,12H2,1-2H3 |
| InChIKey | VAFDMSBDVVGECF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|