C9H13NO3 — CID 15455622
2,3,4-trimethoxyaniline (PubChem CID 15455622) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2,3,4-trimethoxyaniline.
| Compound Name | 2,3,4-trimethoxyaniline |
|---|---|
| PubChem CID | 15455622 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2,3,4-trimethoxyaniline |
| SMILES | COc1ccc(N)c(OC)c1OC |
| InChI | InChI=1S/C9H13NO3/c1-11-7-5-4-6(10)8(12-2)9(7)13-3/h4-5H,10H2,1-3H3 |
| InChIKey | XRARCMOGDHJTAL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|