C15H16FNO3 — CID 61025129
2-fluoro-4-(2,3,4-trimethoxyphenyl)aniline (PubChem CID 61025129) has the molecular formula C15H16FNO3 and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-fluoro-4-(2,3,4-trimethoxyphenyl)aniline.
| Compound Name | 2-fluoro-4-(2,3,4-trimethoxyphenyl)aniline |
|---|---|
| PubChem CID | 61025129 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-fluoro-4-(2,3,4-trimethoxyphenyl)aniline |
| SMILES | COc1ccc(-c2ccc(N)c(F)c2)c(OC)c1OC |
| InChI | InChI=1S/C15H16FNO3/c1-18-13-7-5-10(14(19-2)15(13)20-3)9-4-6-12(17)11(16)8-9/h4-8H,17H2,1-3H3 |
| InChIKey | ZUQBXDIQJUEWLT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|